Online Database of Chemicals from Around the World
|
CAS#: 42506-61-6 Product: 2,6-Dimethyl-4-(2,6-Dimethyl-4H-Thiin-4-Ylideno)-4H-Thiine No suppilers available for the product. |
| Name | 2,6-Dimethyl-4-(2,6-Dimethyl-4H-Thiin-4-Ylideno)-4H-Thiine |
|---|---|
| Synonyms | 4-(2,6-Dimethylthiopyran-4-Ylidene)-2,6-Dimethyl-Thiopyran; 4-(2,6-Dimethyl-4-Thiopyranylidene)-2,6-Dimethylthiopyran; 4H-Thiopyran, 4-(2,6-Dimethyl-4H-Thiopyran-4-Ylidene)-2,6-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C14H16S2 |
| Molecular Weight | 248.40 |
| CAS Registry Number | 42506-61-6 |
| SMILES | CC1=CC(C=C(S1)C)=C2C=C(SC(=C2)C)C |
| InChI | 1S/C14H16S2/c1-9-5-13(6-10(2)15-9)14-7-11(3)16-12(4)8-14/h5-8H,1-4H3 |
| InChIKey | KIVKMHQZJLNIOQ-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.877°C at 760 mmHg (Cal.) |
| Flash point | 131.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-4-(2,6-Dimethyl-4H-Thiin-4-Ylideno)-4H-Thiine |