|
CAS#: 42530-53-0 Product: 8,11-Dichloro-7H-Benz[de]Anthracen-7-One No suppilers available for the product. |
| Name | 8,11-Dichloro-7H-Benz[de]Anthracen-7-One |
|---|---|
| Synonyms | 8,11-Dichloro-7H-Benz(De)Anthracen-7-One |
| Molecular Structure | ![]() |
| Molecular Formula | C17H8Cl2O |
| Molecular Weight | 299.16 |
| CAS Registry Number | 42530-53-0 |
| SMILES | C1=CC(=C4C(=C1Cl)C2=CC=CC3=CC=CC(=C23)C4=O)Cl |
| InChI | 1S/C17H8Cl2O/c18-12-7-8-13(19)16-15(12)10-5-1-3-9-4-2-6-11(14(9)10)17(16)20/h1-8H |
| InChIKey | OZOXKVQQXLLTGP-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.578°C at 760 mmHg (Cal.) |
| Flash point | 213.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,11-Dichloro-7H-Benz[de]Anthracen-7-One |