| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-Amino-5-Phenyl-1H-Pyrazole-4-Carbonitrile |
|---|---|
| Synonyms | 3-Amino-5-phenylpyrazole-4-carbonitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 |
| CAS Registry Number | 42754-61-0 |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NN2)N)C#N |
| InChI | 1S/C10H8N4/c11-6-8-9(13-14-10(8)12)7-4-2-1-3-5-7/h1-5H,(H3,12,13,14) |
| InChIKey | PGZXQQILVKKFAU-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.7±50.0°C at 760 mmHg (Cal.) |
| Flash point | 279.0±30.1°C (Cal.) |
| (1) | Irene C. Christoforou and Panayiotis A. Koutentis. New regiospecific isothiazole C–C coupling chemistry, Org. Biomol. Chem., 2006, 4, 3681. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-5-Phenyl-1H-Pyrazole-4-Carbonitrile |