|
CAS#: 42829-14-1 Product: 3,3,4-Trichlorothiolane 1,1-Dioxide No suppilers available for the product. |
| Name | 3,3,4-Trichlorothiolane 1,1-Dioxide |
|---|---|
| Synonyms | 2,3,3-Trichlorosulfolane; Thiophene, Tetrahydro-3,3,4-Trichloro-, 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C4H5Cl3O2S |
| Molecular Weight | 223.50 |
| CAS Registry Number | 42829-14-1 |
| SMILES | O=[S]1(CCC(C1Cl)(Cl)Cl)=O |
| InChI | 1S/C4H5Cl3O2S/c5-3-4(6,7)1-2-10(3,8)9/h3H,1-2H2 |
| InChIKey | KZEUNCRYJWXNSC-UHFFFAOYSA-N |
| Density | 1.692g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.325°C at 760 mmHg (Cal.) |
| Flash point | 188.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4-Trichlorothiolane 1,1-Dioxide |