|
CAS#: 42839-91-8 Product: 3-Methoxy-2-Methylfluoren-9-One No suppilers available for the product. |
| Name | 3-Methoxy-2-Methylfluoren-9-One |
|---|---|
| Synonyms | 3-Methoxy-2-Methyl-Fluoren-9-One; 3-Methoxy-2-Methyl-9-Fluorenone; Nsc48301 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 42839-91-8 |
| SMILES | C1=C(C(=CC2=C1C(=O)C3=C2C=CC=C3)OC)C |
| InChI | 1S/C15H12O2/c1-9-7-13-12(8-14(9)17-2)10-5-3-4-6-11(10)15(13)16/h3-8H,1-2H3 |
| InChIKey | HQULSBFZRSUNDA-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.618°C at 760 mmHg (Cal.) |
| Flash point | 193.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-2-Methylfluoren-9-One |