Online Database of Chemicals from Around the World
|
CAS#: 42863-81-0 Product: 7-Chloro-5-(2-Chlorophenyl)-3-Hydroxy-1,3-Dihydropyrido[2,3-f][1,4]Diazepin-2-One No suppilers available for the product. |
| Name | 7-Chloro-5-(2-Chlorophenyl)-3-Hydroxy-1,3-Dihydropyrido[2,3-f][1,4]Diazepin-2-One |
|---|---|
| Synonyms | D-12524; Lopirazepam |
| Molecular Structure | ![CAS#: 42863-81-0, 7-Chloro-5-(2-Chlorophenyl)-3-Hydroxy-1,3-Dihydropyrido[2,3-f][1,4]Diazepin-2-One](/moreStructures/42863-81-0.gif) |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 |
| CAS Registry Number | 42863-81-0 |
| EINECS | 255-974-1 |
| SMILES | C3=C(C1=NC(C(=O)NC2=C1N=C(Cl)C=C2)O)C(=CC=C3)Cl |
| InChI | 1S/C14H9Cl2N3O2/c15-8-4-2-1-3-7(8)11-12-9(5-6-10(16)18-12)17-13(20)14(21)19-11/h1-6,14,21H,(H,17,20) |
| InChIKey | JEJOFYTVMFVKQA-UHFFFAOYSA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.897°C at 760 mmHg (Cal.) |
| Flash point | 294.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-5-(2-Chlorophenyl)-3-Hydroxy-1,3-Dihydropyrido[2,3-f][1,4]Diazepin-2-One |