| Name | 4,6-Dichloro-2-Phenyl-2,4-Cyclohexadien-1-Imine |
|---|---|
| Synonyms | 3,5-dichloro-2-nitrenebiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9Cl2N |
| Molecular Weight | 238.11 |
| CAS Registry Number | 42935-10-4 |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(C2=N)Cl)Cl |
| InChI | 1S/C12H9Cl2N/c13-9-6-10(12(15)11(14)7-9)8-4-2-1-3-5-8/h1-7,11,15H |
| InChIKey | ZNHCBGWWANOJRC-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 186.7±27.9°C (Cal.) |
| (1) | Nina P. Gritsan, Dmitrii A. Polshakov, Meng-Lin Tsao and Matthew S. Platz. A study of 2-azido-3,5-dichlorobiphenyl by nano- and picosecond laser flash photolysis and computational methods, Photochem. Photobiol. Sci., 2005, 4, 23. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-2-Phenyl-2,4-Cyclohexadien-1-Imine |