|
CAS#: 42959-99-9 Product: (2-Bromo-3-Nitrophenyl) Phenyl Ketone No suppilers available for the product. |
| Name | (2-Bromo-3-Nitrophenyl) Phenyl Ketone |
|---|---|
| Synonyms | (2-Bromo-3-Nitro-Phenyl)-Phenyl-Methanone; (2-Bromo-3-Nitrophenyl) Phenyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8BrNO3 |
| Molecular Weight | 306.12 |
| CAS Registry Number | 42959-99-9 |
| EINECS | 256-020-7 |
| SMILES | C2=C([N+]([O-])=O)C(=C(C(=O)C1=CC=CC=C1)C=C2)Br |
| InChI | 1S/C13H8BrNO3/c14-12-10(7-4-8-11(12)15(17)18)13(16)9-5-2-1-3-6-9/h1-8H |
| InChIKey | CXJKOOUMPLYFMK-UHFFFAOYSA-N |
| Density | 1.565g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.832°C at 760 mmHg (Cal.) |
| Flash point | 191.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Bromo-3-Nitrophenyl) Phenyl Ketone |