Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3-alpha-Acetyldiacetoxyscirpenol |
|---|---|
| Synonyms | 3-.Alpha.-Acetyldiacetoxyscirphenol; Anguidine, Acetyl(Triacetoxyscirpene); Acetylanguidine |
| Molecular Structure |  |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 |
| CAS Registry Number | 4297-61-4 |
| SMILES | [C@]24([C@]1(OC1)[C@@H](OC3C2(CCC(=C3)C)COC(=O)C)[C@@H](OC(=O)C)C4OC(=O)C)C |
| InChI | 1S/C21H28O8/c1-11-6-7-20(9-25-12(2)22)15(8-11)29-18-16(27-13(3)23)17(28-14(4)24)19(20,5)21(18)10-26-21/h8,15-18H,6-7,9-10H2,1-5H3/t15?,16-,17?,18-,19-,20?,21+/m0/s1 |
| InChIKey | YWQOKOBRSAAKTG-OWJJINAQSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.352°C at 760 mmHg (Cal.) |
| Flash point | 206.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-alpha-Acetyldiacetoxyscirpenol |