|
CAS#: 43042-33-7 Product: 4,4'-Dimethoxy[Bi-1,4-Cyclohexadien-1-Yl]-3,3',6,6'-Tetraone No suppilers available for the product. |
| Name | 4,4'-Dimethoxy[Bi-1,4-Cyclohexadien-1-Yl]-3,3',6,6'-Tetraone |
|---|---|
| Synonyms | 2-Methoxy-5-(4-Methoxy-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-1,4-Benzoquinone; 2-(3,6-Diketo-4-Methoxy-1-Cyclohexa-1,4-Dienyl)-5-Methoxy-P-Benzoquinone; Nsc403618 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 |
| CAS Registry Number | 43042-33-7 |
| EINECS | 256-058-4 |
| SMILES | COC1=CC(=O)C(=CC1=O)C2=CC(=O)C(=CC2=O)OC |
| InChI | 1S/C14H10O6/c1-19-13-5-9(15)7(3-11(13)17)8-4-12(18)14(20-2)6-10(8)16/h3-6H,1-2H3 |
| InChIKey | LWLDSDSFXSSEQR-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.863°C at 760 mmHg (Cal.) |
| Flash point | 182.814°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dimethoxy[Bi-1,4-Cyclohexadien-1-Yl]-3,3',6,6'-Tetraone |