|
CAS#: 43085-97-8 Product: 3-Hydroxyestra-1,3,5(10),7-Tetraen-17-One 3-Acetate No suppilers available for the product. |
| Name | 3-Hydroxyestra-1,3,5(10),7-Tetraen-17-One 3-Acetate |
|---|---|
| Synonyms | Acetic Acid [(9S,13S,14S)-13-Methyl-17-Oxo-9,11,12,14,15,16-Hexahydro-6H-Cyclopenta[A]Phenanthren-3-Yl] Ester; Acetic Acid [(9S,13S,14S)-17-Keto-13-Methyl-9,11,12,14,15,16-Hexahydro-6H-Cyclopenta[A]Phenanthren-3-Yl] Ester; [(9S,13S,14S)-13-Methyl-17-Oxo-9,11,12,14,15,16-Hexahydro-6H-Cyclopenta[A]Phenanthren-3-Yl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 |
| CAS Registry Number | 43085-97-8 |
| EINECS | 256-082-5 |
| SMILES | [C@H]14C(=CCC2=C1C=CC(=C2)OC(C)=O)[C@H]3[C@](C(=O)CC3)(C)CC4 |
| InChIKey | DBXQAPGFWYIOGN-KPFFTGBYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.644°C at 760 mmHg (Cal.) |
| Flash point | 205.23°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxyestra-1,3,5(10),7-Tetraen-17-One 3-Acetate |