|
CAS#: 43126-83-6 Product: Silver Tert-Dodecanethiolate No suppilers available for the product. |
| Name | Silver Tert-Dodecanethiolate |
|---|---|
| Synonyms | Tert-Dodecanethiol, Silver(1+) Salt; Silver Tert-Dodecanethiolate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25AgS |
| Molecular Weight | 309.26 |
| CAS Registry Number | 43126-83-6 |
| EINECS | 256-108-5 |
| SMILES | C(C(C)(C)[S-])CCCCCCCC.[Ag+] |
| InChI | 1S/C12H26S.Ag/c1-4-5-6-7-8-9-10-11-12(2,3)13;/h13H,4-11H2,1-3H3;/q;+1/p-1 |
| InChIKey | SLGISBQSCKTOME-UHFFFAOYSA-M |
| Boiling point | 257.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 93.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Silver Tert-Dodecanethiolate |