|
CAS#: 43189-32-8 Product: Methyl DL-Methionate No suppilers available for the product. |
| Name | Methyl DL-Methionate |
|---|---|
| Synonyms | [(1R)-1-Methoxycarbonyl-3-Methylsulfanyl-Propyl]Ammonium; [(1R)-1-Methoxycarbonyl-3-(Methylthio)Propyl]Ammonium; [(1R)-1-Carbomethoxy-3-(Methylthio)Propyl]Ammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14NO2S |
| Molecular Weight | 164.24 |
| CAS Registry Number | 43189-32-8 |
| EINECS | 256-133-1 |
| SMILES | [C@@H]([NH3+])(CCSC)C(OC)=O |
| InChI | 1S/C6H13NO2S/c1-9-6(8)5(7)3-4-10-2/h5H,3-4,7H2,1-2H3/p+1/t5-/m1/s1 |
| InChIKey | UIHPNZDZCOEZEN-RXMQYKEDSA-O |
| Boiling point | 240.035°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 98.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl DL-Methionate |