| Name | Cholesta-5,7-Diene-1 alpha,3 beta-Diol |
|---|---|
| Synonyms | (1S,3R,9S,10R,13R,14R,17R)-17-[(1R)-1,5-Dimethylhexyl]-10,13-Dimethyl-2,3,4,9,11,12,14,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthrene-1,3-Diol; Cdabd; Cholesta-5,7-Diene-1,3-Diol, (1Alpha,3Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.64 |
| CAS Registry Number | 43217-89-6 |
| SMILES | [C@H]12[C@@]([C@H](CC1)[C@@H](CCCC(C)C)C)(CC[C@H]3C2=CC=C4[C@@]3([C@@H](O)C[C@H](O)C4)C)C |
| InChI | 1S/C27H44O2/c1-17(2)7-6-8-18(3)22-11-12-23-21-10-9-19-15-20(28)16-25(29)27(19,5)24(21)13-14-26(22,23)4/h9-10,17-18,20,22-25,28-29H,6-8,11-16H2,1-5H3/t18-,20-,22-,23+,24+,25+,26-,27+/m1/s1 |
| InChIKey | PJEIBQWLLDBCCO-FDUUVPPLSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.974°C at 760 mmHg (Cal.) |
| Flash point | 222.33°C (Cal.) |
| (1) | Shinichiro Fuse, Yuto Mifune, Nobutake Tanabe and Takashi Takahashi. Continuous-flow synthesis of activated vitamin D and its analogues, Org. Biomol. Chem., 2012, 10, 5205. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Cholesta-5,7-Diene-1 alpha,3 beta-Diol |