|
CAS#: 4335-89-1 Product: 2-Methoxy-3,3,5-Trimethyl-2,3-Dihydro-1,2-Oxaphosphole 2-Oxide No suppilers available for the product. |
| Name | 2-Methoxy-3,3,5-Trimethyl-2,3-Dihydro-1,2-Oxaphosphole 2-Oxide |
|---|---|
| Synonyms | Brn 0511186; 1,2-Oxaphosphol-4-Ene, 2-Methoxy-3,3,5-Trimethyl-, 2-Oxide; 2-Methoxy-3,3,5-Trimethyl-1,2-Oxaphosphol-4-Ene 2-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13O3P |
| Molecular Weight | 176.15 |
| CAS Registry Number | 4335-89-1 |
| SMILES | CC1([P](OC(=C1)C)(OC)=O)C |
| InChI | 1S/C7H13O3P/c1-6-5-7(2,3)11(8,9-4)10-6/h5H,1-4H3 |
| InChIKey | KCKJPIBIGFUZAS-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.219°C at 760 mmHg (Cal.) |
| Flash point | 98.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-3,3,5-Trimethyl-2,3-Dihydro-1,2-Oxaphosphole 2-Oxide |