|
CAS#: 434-39-9 Product: 1,1,1-Trifluoro-3-Nitro-Butan-2-Ol No suppilers available for the product. |
| Name | 1,1,1-Trifluoro-3-Nitro-Butan-2-Ol |
|---|---|
| Synonyms | 1,1,1-Trifluoro-3-Nitro-Butan-2-Ol; Nsc3640 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6F3NO3 |
| Molecular Weight | 173.09 |
| CAS Registry Number | 434-39-9 |
| SMILES | CC([N+]([O-])=O)C(O)C(F)(F)F |
| InChI | 1S/C4H6F3NO3/c1-2(8(10)11)3(9)4(5,6)7/h2-3,9H,1H3 |
| InChIKey | PKQGAGPKSOAOPY-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.768°C at 760 mmHg (Cal.) |
| Flash point | 88.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trifluoro-3-Nitro-Butan-2-Ol |