|
CAS#: 4356-32-5 Product: Methyl 3beta-Hydroxy-20-Oxo-30-Norlupan-28-Oate No suppilers available for the product. |
| Name | Methyl 3beta-Hydroxy-20-Oxo-30-Norlupan-28-Oate |
|---|---|
| Synonyms | Methyl 3Beta-Hydroxy-20-Oxo-30-Norlupan-28-Oate |
| Molecular Structure | ![]() |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 |
| CAS Registry Number | 4356-32-5 |
| EINECS | 224-430-5 |
| SMILES | [C@@]35([C@]2([C@@H]([C@]1(CC[C@@H](C([C@@H]1CC2)(C)C)O)C)CC[C@@H]3[C@H]4[C@@H](CC[C@@]4(CC5)C(=O)OC)C(=O)C)C)C |
| InChI | 1S/C30H48O4/c1-18(31)19-10-15-30(25(33)34-7)17-16-28(5)20(24(19)30)8-9-22-27(4)13-12-23(32)26(2,3)21(27)11-14-29(22,28)6/h19-24,32H,8-17H2,1-7H3/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
| InChIKey | ZHIVKEAQDLRABF-FZFNOLFKSA-N |
| Density | 1.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.16°C at 760 mmHg (Cal.) |
| Flash point | 164.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3beta-Hydroxy-20-Oxo-30-Norlupan-28-Oate |