|
CAS#: 4366-50-1 Product: N-Ethyl-N-1-Naphthalenyl-Thiourea No suppilers available for the product. |
| Name | N-Ethyl-N-1-Naphthalenyl-Thiourea |
|---|---|
| Synonyms | 1-Ethyl-1-(1-Naphthyl)Thiourea; 1-Ethyl-1-Naphthalen-1-Yl-Thiourea; Brn 2110695 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.33 |
| CAS Registry Number | 4366-50-1 |
| SMILES | C2=C1C(=CC=CC1=CC=C2)N(C(N)=S)CC |
| InChI | 1S/C13H14N2S/c1-2-15(13(14)16)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3,(H2,14,16) |
| InChIKey | KIJJAHDWPAWNGH-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.877°C at 760 mmHg (Cal.) |
| Flash point | 187.172°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-N-1-Naphthalenyl-Thiourea |