|
CAS#: 4372-02-5 Product: Disodium 2-(4,5-Dibromo-6-Oxido-3-Oxoxanthen-9-Yl)Benzoate No suppilers available for the product. |
| Name | Disodium 2-(4,5-Dibromo-6-Oxido-3-Oxoxanthen-9-Yl)Benzoate |
|---|---|
| Synonyms | Disodium 4',5'-Dibromo-3-Oxo-Spiro[Isobenzofuran-1,9'-Xanthene]-3',6'-Diolate; Disodium 4',5'-Dibromo-3-Oxospiro[Isobenzofuran-1,9'-Xanthene]-3',6'-Diolate; Disodium 4',5'-Dibromo-3-Keto-Spiro[Isobenzofuran-1,9'-Xanthene]-3',6'-Diolate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H8Br2Na2O5 |
| Molecular Weight | 534.07 |
| CAS Registry Number | 4372-02-5 |
| EINECS | 224-468-2 |
| SMILES | C1=CC(=C(Br)C4=C1C2(OC(=O)C3=CC=CC=C23)C5=C(O4)C(=C([O-])C=C5)Br)[O-].[Na+].[Na+] |
| InChI | 1S/C20H10Br2O5.2Na/c21-15-13(23)7-5-11-17(15)26-18-12(6-8-14(24)16(18)22)20(11)10-4-2-1-3-9(10)19(25)27-20;;/h1-8,23-24H;;/q;2*+1/p-2 |
| InChIKey | REXANTGEEZXBSJ-UHFFFAOYSA-L |
| Boiling point | 633.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium 2-(4,5-Dibromo-6-Oxido-3-Oxoxanthen-9-Yl)Benzoate |