|
CAS#: 4373-40-4 Product: 2,3-Dimethoxy-5,6-Dimethyl-2-Cyclohexene-1,4-Dione No suppilers available for the product. |
| Name | 2,3-Dimethoxy-5,6-Dimethyl-2-Cyclohexene-1,4-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 4373-40-4 |
| SMILES | CO\C1=C(/OC)C(=O)C(C)C(C)C1=O |
| InChI | 1S/C10H14O4/c1-5-6(2)8(12)10(14-4)9(13-3)7(5)11/h5-6H,1-4H3 |
| InChIKey | OTGRRZBXIQUVOS-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.094°C at 760 mmHg (Cal.) |
| Flash point | 145.725°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethoxy-5,6-Dimethyl-2-Cyclohexene-1,4-Dione |