|
CAS#: 438-25-5 Product: 3-Ethyl-1,1,1-Trifluoro-Heptane-2,4-Dione No suppilers available for the product. |
| Name | 3-Ethyl-1,1,1-Trifluoro-Heptane-2,4-Dione |
|---|---|
| Synonyms | 3-Ethyl-1,1,1-Trifluoro-Heptane-2,4-Dione; Nsc42766 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.20 |
| CAS Registry Number | 438-25-5 |
| SMILES | C(C(C(=O)C(F)(F)F)C(CCC)=O)C |
| InChI | 1S/C9H13F3O2/c1-3-5-7(13)6(4-2)8(14)9(10,11)12/h6H,3-5H2,1-2H3 |
| InChIKey | BHQIXRJKTWWITR-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.063°C at 760 mmHg (Cal.) |
| Flash point | 66.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-1,1,1-Trifluoro-Heptane-2,4-Dione |