|
CAS#: 4389-39-3 Product: 2-Hydroxy-1,2-Bis(2-Methylphenyl)Ethanone No suppilers available for the product. |
| Name | 2-Hydroxy-1,2-Bis(2-Methylphenyl)Ethanone |
|---|---|
| Synonyms | O-Toluoin; Nsc121791 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 4389-39-3 |
| SMILES | C1=CC=CC(=C1C(=O)C(C2=C(C)C=CC=C2)O)C |
| InChI | 1S/C16H16O2/c1-11-7-3-5-9-13(11)15(17)16(18)14-10-6-4-8-12(14)2/h3-10,15,17H,1-2H3 |
| InChIKey | AISGCPJYLZUZOS-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.426°C at 760 mmHg (Cal.) |
| Flash point | 168.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-1,2-Bis(2-Methylphenyl)Ethanone |