| Name | 1-(2-Chlorophenyl)Isoquinoline |
|---|---|
| Synonyms | 1-(2-Chloro-phenyl)-isoquinoline; InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10ClN |
| Molecular Weight | 239.70 |
| CAS Registry Number | 439614-58-1 |
| SMILES | C1=CC=C2C(=C1)C=CN=C2C3=CC=CC=C3Cl |
| InChI | 1S/C15H10ClN/c16-14-8-4-3-7-13(14)15-12-6-2-1-5-11(12)9-10-17-15/h1-10H |
| InChIKey | XCBXOXQHBSFYBO-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.8±22.0°C at 760 mmHg (Cal.) |
| Flash point | 202.7±7.9°C (Cal.) |
| Refractive index | 1.661 (Cal.) |
| (1) | Yves L. Janin, Emmanuel Roulland, Arnaud Beurdeley-Thomas, Didier Decaudin, Claude Monneret and Marie-France Poupon. Synthetic approaches to 1-(2-chlorophenyl)isoquinoline-3-carboxylic acid, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 529. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorophenyl)Isoquinoline |