|
CAS#: 4399-08-0 Product: 2,2-Bis(4-Chlorophenyl)-1,1,1-Tribromoethane No suppilers available for the product. |
| Name | 2,2-Bis(4-Chlorophenyl)-1,1,1-Tribromoethane |
|---|---|
| Synonyms | Benzene, 1,1'-(2,2,2-Tribromoethylidene)Bis[4-Chloro-; Ethane, 1,1,1-Tribromo-2,2-Bis(P-Chlorophenyl)-; Nsc406587 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Br3Cl2 |
| Molecular Weight | 487.84 |
| CAS Registry Number | 4399-08-0 |
| SMILES | C1=CC(=CC=C1Cl)C(C2=CC=C(C=C2)Cl)C(Br)(Br)Br |
| InChI | 1S/C14H9Br3Cl2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13H |
| InChIKey | CCSXMKDJTJMYHF-UHFFFAOYSA-N |
| Density | 1.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.488°C at 760 mmHg (Cal.) |
| Flash point | 241.12°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis(4-Chlorophenyl)-1,1,1-Tribromoethane |