|
CAS#: 4412-35-5 Product: 8-Allyl-3-Methyl-2-Phenyl-4H-Chromen-4-One No suppilers available for the product. |
| Name | 8-Allyl-3-Methyl-2-Phenyl-4H-Chromen-4-One |
|---|---|
| Synonyms | 4H-1-Benzopyran-4-one, 3-methyl-2-phenyl-8-(2-propenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 4412-35-5 |
| SMILES | C=CCc3cccc1c3O/C(=C(/C)C1=O)c2ccccc2 |
| InChI | 1S/C19H16O2/c1-3-8-14-11-7-12-16-17(20)13(2)18(21-19(14)16)15-9-5-4-6-10-15/h3-7,9-12H,1,8H2,2H3 |
| InChIKey | CPMKAFLZWFEHBO-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.348°C at 760 mmHg (Cal.) |
| Flash point | 188.784°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Allyl-3-Methyl-2-Phenyl-4H-Chromen-4-One |