|
CAS#: 4413-31-4 Product: 1,1,1-Trichloro-2,2-Bis(Para-Ethylphenyl)Ethane No suppilers available for the product. |
| Name | 1,1,1-Trichloro-2,2-Bis(Para-Ethylphenyl)Ethane |
|---|---|
| Synonyms | Aids-166935; Aids166935; Benzene, 1,1'-(2,2,2-Trichloroethylidene)Bis[4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15Cl3 |
| Molecular Weight | 313.65 |
| CAS Registry Number | 4413-31-4 |
| SMILES | C1=CC(=CC=C1C)C(C2=CC=C(C=C2)C)C(Cl)(Cl)Cl |
| InChI | 1S/C16H15Cl3/c1-11-3-7-13(8-4-11)15(16(17,18)19)14-9-5-12(2)6-10-14/h3-10,15H,1-2H3 |
| InChIKey | OEMKCHJUXPTUHW-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.218°C at 760 mmHg (Cal.) |
| Flash point | 272.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trichloro-2,2-Bis(Para-Ethylphenyl)Ethane |