Online Database of Chemicals from Around the World
| No suppilers available for the product. |
| Name | 3-Amino-N-(Phenylsulphonyl)Benzenesulphonamide |
|---|---|
| Synonyms | 3-Amino-N-Phenylsulfonyl-Benzenesulfonamide; 3-Amino-N-(Phenylsulphonyl)Benzenesulphonamide |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.36 |
| CAS Registry Number | 4431-68-9 |
| EINECS | 224-630-2 |
| SMILES | C1=C(N)C=CC=C1[S](N[S](=O)(=O)C2=CC=CC=C2)(=O)=O |
| InChI | 1S/C12H12N2O4S2/c13-10-5-4-8-12(9-10)20(17,18)14-19(15,16)11-6-2-1-3-7-11/h1-9,14H,13H2 |
| InChIKey | QRRXGUYBWCPMGI-UHFFFAOYSA-N |
| Desity | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.493°C at 760 mmHg (Cal.) |
| Flash point | 289.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-N-(Phenylsulphonyl)Benzenesulphonamide |