|
CAS#: 4445-59-4 Product: 3,5-Biphenyldiyl Bis(Hydrogen Carbonate) No suppilers available for the product. |
| Name | 3,5-Biphenyldiyl Bis(Hydrogen Carbonate) |
|---|---|
| Synonyms | [1,1'-Biphenyl]-3,5-dicarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 |
| CAS Registry Number | 4445-59-4 |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)OC(=O)O)OC(=O)O |
| InChI | 1S/C14H10O6/c15-13(16)19-11-6-10(9-4-2-1-3-5-9)7-12(8-11)20-14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | UYRDYMWHGAUSMU-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.6±60.0°C at 760 mmHg (Cal.) |
| Flash point | 205.0±26.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Biphenyldiyl Bis(Hydrogen Carbonate) |