| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Genisteine |
|---|---|
| Synonyms | Inchi=1/C15h26n2/C1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/H12-15H,1-11H; (-)-Beta-Isosparteine; 7,14-Methano-2H,6H-Dipyrido(1,2-A:1',2'-E)(1,5)Diazocine, Dodecahydro-, (7S-(7Alpha,7Abeta,14Alpha,14Abeta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.38 |
| CAS Registry Number | 446-95-7 |
| EINECS | 207-177-5 |
| SMILES | [C@@H]13[C@H]4N(C[C@@H]([C@H]2N(C1)CCCC2)C3)CCCC4 |
| InChI | 1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | SLRCCWJSBJZJBV-AJNGGQMLSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.892°C at 760 mmHg (Cal.) |
| Flash point | 148.344°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Genisteine |