Online Database of Chemicals from Around the World
|
CAS#: 4466-77-7 Product: 1,2,3,4-Tetramethylphenanthrene No suppilers available for the product. |
| Name | 1,2,3,4-Tetramethylphenanthrene |
|---|---|
| Synonyms | Tetramethylphenanthrene; 4-05-00-02372 (Beilstein Handbook Reference); Brn 2097713 |
| Molecular Structure |  |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 4466-77-7 |
| SMILES | C1=CC3=C(C2=C(C)C(=C(C)C(=C12)C)C)C=CC=C3 |
| InChI | 1S/C18H18/c1-11-12(2)14(4)18-16(13(11)3)10-9-15-7-5-6-8-17(15)18/h5-10H,1-4H3 |
| InChIKey | OGWJPJREDQYLQD-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.573°C at 760 mmHg (Cal.) |
| Flash point | 195.064°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetramethylphenanthrene |