|
CAS#: 44805-33-6 Product: L-Ornithine Monohydrobromide No suppilers available for the product. |
| Name | L-Ornithine Monohydrobromide |
|---|---|
| Synonyms | (2S)-2,5-Diaminovaleric Acid Hydrobromide; L-Ornithine Monohydrobromide |
| Molecular Structure | ![]() |
| Molecular Formula | C5H13BrN2O2 |
| Molecular Weight | 213.07 |
| CAS Registry Number | 44805-33-6 |
| EINECS | 256-164-0 |
| SMILES | [C@H](N)(CCCN)C(O)=O.[H+].[Br-] |
| InChI | 1S/C5H12N2O2.BrH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m0./s1 |
| InChIKey | GWRQMKDBBHFVIZ-WCCKRBBISA-N |
| Boiling point | 308.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 140.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Ornithine Monohydrobromide |