| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S)-Amino(5-Hydroxy-1H-Pyrazol-4-Yl)Acetic Acid |
|---|---|
| Synonyms | (2S)-2-(3-hydroxy-2H-pyrazol-4-yl)glycine; (S)-2-amino-2-(3-oxo-2,3-dihydro-1H-pyrazol-4-yl)acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 |
| CAS Registry Number | 449153-25-7 |
| SMILES | C1=NNC(=C1[C@@H](C(=O)O)N)O |
| InChI | 1S/C5H7N3O3/c6-3(5(10)11)2-1-7-8-4(2)9/h1,3H,6H2,(H,10,11)(H2,7,8,9)/t3-/m0/s1 |
| InChIKey | KKKAMHOMHLDAHM-VKHMYHEASA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.4±50.0°C at 760 mmHg (Cal.) |
| Flash point | 258.2±30.1°C (Cal.) |
| Refractive index | 1.701 (Cal.) |
| (1) | Peter B. Hitchcock, Konstantinos Papadopoulos and Douglas W. Young. β-Lactams as versatile synthons for homochiral ibotenate analogues with potential for activity at glutamate receptors, Org. Biomol. Chem., 2003, 1, 2670. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-Amino(5-Hydroxy-1H-Pyrazol-4-Yl)Acetic Acid |