|
CAS#: 4514-19-6 Product: 12-Methylbenzo[a]Pyrene No suppilers available for the product. |
| Name | 12-Methylbenzo[a]Pyrene |
|---|---|
| Synonyms | Ccris 2445; 12-Methylbenzo(A)Pyrene; 4-05-00-02695 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 4514-19-6 |
| SMILES | C1=C(C4=C3C2=C1C5=C(C=C2C=CC3=CC=C4)C=CC=C5)C |
| InChI | 1S/C21H14/c1-13-11-19-18-7-3-2-5-15(18)12-16-10-9-14-6-4-8-17(13)20(14)21(16)19/h2-12H,1H3 |
| InChIKey | FLMPDOQIFWNZJZ-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.361°C at 760 mmHg (Cal.) |
| Flash point | 236.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Methylbenzo[a]Pyrene |