| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,5-Anhydro-4-Deoxy-4-Methyl-1-Thio-D-Ribitol |
|---|---|
| Synonyms | (3R,4R,5S)-3,4-Dihydroxy-5-methylthiane; (3R,4R,5S)-5-methyltetrahydro-2H-thiopyran-3,4-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.22 |
| CAS Registry Number | 451478-21-0 |
| SMILES | C[C@@H]1CSC[C@@H]([C@@H]1O)O |
| InChI | 1S/C6H12O2S/c1-4-2-9-3-5(7)6(4)8/h4-8H,2-3H2,1H3/t4-,5+,6-/m1/s1 |
| InChIKey | KRYKGOWEDDPPOJ-NGJCXOISSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.8±40.0°C at 760 mmHg (Cal.) |
| Flash point | 125.4±26.0°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| (1) | Víctor Ulgar, José G. Fernández-Bolaños and Mikael Bols. Synthesis and evaluation of sulfonium analogues of isofucofagomine as glycosidase inhibitors, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 1242. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,5-Anhydro-4-Deoxy-4-Methyl-1-Thio-D-Ribitol |