Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Nitracrine |
|---|---|
| Synonyms | 9-(3-Dimethylaminopropylamino)-N-Hydroxyacridin-1-Amine Oxide; N-[9-(3-Dimethylaminopropylamino)Acridin-1-Yl]-N-Oxidohydroxylamine; N-[9-(3-Dimethylaminopropylamino)Acridin-1-Yl]-N-Oxido-Hydroxylamine |
| Molecular Structure |  |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 |
| CAS Registry Number | 4533-39-5 |
| SMILES | C1=C2C(=C(C=C1)[N+](=O)[O-])C(=C3C(=N2)C=CC=C3)NCCCN(C)C |
| InChI | 1S/C18H20N4O2/c1-21(2)12-6-11-19-18-13-7-3-4-8-14(13)20-15-9-5-10-16(17(15)18)22(23)24/h3-5,7-10H,6,11-12H2,1-2H3,(H,19,20) |
| InChIKey | YMVWGSQGCWCDGW-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 269.5±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitracrine |