Online Database of Chemicals from Around the World
|
CAS#: 453590-24-4 Product: 6-(4-Methoxyphenyl)Furo[2,3-d]Pyrimidin-4-Amine No suppilers available for the product. |
| Name | 6-(4-Methoxyphenyl)Furo[2,3-d]Pyrimidin-4-Amine |
|---|---|
| Synonyms | 6-(4-Methoxy-phenyl)-furo[2,3-d]pyrimidin-4-ylamine; furo[2,3-d]pyrimidine deriv. 10a |
| Molecular Structure | ![CAS#: 453590-24-4, 6-(4-Methoxyphenyl)Furo[2,3-d]Pyrimidin-4-Amine](/moreStructures/453590-24-4.gif) |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 |
| CAS Registry Number | 453590-24-4 |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(N=CN=C3O2)N |
| InChI | 1S/C13H11N3O2/c1-17-9-4-2-8(3-5-9)11-6-10-12(14)15-7-16-13(10)18-11/h2-7H,1H3,(H2,14,15,16) |
| InChIKey | DIJLFIHLUYAZCI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 226.2±28.7°C (Cal.) |
| Refractive index | 1.66 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(4-Methoxyphenyl)Furo[2,3-d]Pyrimidin-4-Amine |