Online Database of Chemicals from Around the World
| No suppilers available for the product. |
| Name | 4,5a-Epoxy-3-Hydroxy-6-Methoxy-a,17-Dimethyl-a-Propyl-6b,14-Ethenomorphinan-7-Methanol |
|---|---|
| Synonyms | 6,14-Endoetheno-7-(2-Hydroxy-2-Pentyl)Tetrahydro-Oripavine; Morphinan-3-Ol, 6,14-Endoetheno-4,5-Alpha-Epoxy-7-(2-Hydroxy-2-Pentyl)-6-Methoxy-17-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 |
| CAS Registry Number | 4562-22-5 |
| SMILES | [C@]134[C@H]5OC2=C(O)C=CC(=C12)C[C@@H](N(CC3)C)C46CC(C5(OC)C=C6)C(O)(CCC)C |
| InChI | 1S/C25H33NO4/c1-5-8-22(2,28)17-14-23-9-10-25(17,29-4)21-24(23)11-12-26(3)18(23)13-15-6-7-16(27)20(30-21)19(15)24/h6-7,9-10,17-18,21,27-28H,5,8,11-14H2,1-4H3/t17?,18-,21-,22?,23?,24+,25?/m1/s1 |
| InChIKey | CAHCBJPUTCKATP-NSLQELFPSA-N |
| Desity | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.651°C at 760 mmHg (Cal.) |
| Flash point | 286.219°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5a-Epoxy-3-Hydroxy-6-Methoxy-a,17-Dimethyl-a-Propyl-6b,14-Ethenomorphinan-7-Methanol |