Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2'',3,3',3'''-Tetramethyl-1,1':4',1'':4'',1'''-Quaterphenyl |
|---|---|
| Synonyms | 2'',3,3',3'''-Tetramethyl-1,1':4',1'':4'',1'''-Quaterphenyl |
| Molecular Structure |  |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.51 |
| CAS Registry Number | 4575-13-7 |
| EINECS | 224-960-7 |
| SMILES | C3=C(C2=C(C=C(C1=CC=CC(=C1)C)C=C2)C)C(=CC(=C3)C4=CC=CC(=C4)C)C |
| InChI | 1S/C28H26/c1-19-7-5-9-23(15-19)25-11-13-27(21(3)17-25)28-14-12-26(18-22(28)4)24-10-6-8-20(2)16-24/h5-18H,1-4H3 |
| InChIKey | IVWXXNXSMQULGO-UHFFFAOYSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.298°C at 760 mmHg (Cal.) |
| Flash point | 259.755°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'',3,3',3'''-Tetramethyl-1,1':4',1'':4'',1'''-Quaterphenyl |