|
CAS#: 4592-97-6 Product: 2,3,5-Trichloro-6-methyl-1,4-benzoquinone No suppilers available for the product. |
| Name | 2,3,5-Trichloro-6-methyl-1,4-benzoquinone |
|---|---|
| Synonyms | 2,3,5-Trichloro-6-Methyl-1,4-Benzoquinone; 2,3,5-Trichloro-6-Methyl-P-Benzoquinone; 2,3,5-Trichloro-6-Methyl-Cyclohexa-2,5-Diene-1,4-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C7H3Cl3O2 |
| Molecular Weight | 225.46 |
| CAS Registry Number | 4592-97-6 |
| SMILES | CC1=C(Cl)C(=O)C(=C(Cl)C1=O)Cl |
| InChI | 1S/C7H3Cl3O2/c1-2-3(8)7(12)5(10)4(9)6(2)11/h1H3 |
| InChIKey | ZBWPOKNIKGLQBA-UHFFFAOYSA-N |
| Density | 1.6g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.729°C at 760 mmHg (Cal.) |
| Flash point | 109.92°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5-Trichloro-6-methyl-1,4-benzoquinone |