|
CAS#: 46021-27-6 Product: (1R,2R)-1,2-Cyclohexanedicarbonyl Dichloride No suppilers available for the product. |
| Name | (1R,2R)-1,2-Cyclohexanedicarbonyl Dichloride |
|---|---|
| Synonyms | (1R,2R)-cyclohexane-1,2-dicarbonyl dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10Cl2O2 |
| Molecular Weight | 209.07 |
| CAS Registry Number | 46021-27-6 |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)Cl)C(=O)Cl |
| InChI | 1S/C8H10Cl2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h5-6H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | YKZFIPRBWVEQBE-PHDIDXHHSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.9±33.0°C at 760 mmHg (Cal.) |
| Flash point | 119.4±21.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-1,2-Cyclohexanedicarbonyl Dichloride |