|
CAS#: 4615-69-4 Product: 2-Methyl-5-Nitro-1H-Benzimidazole 3-Oxide No suppilers available for the product. |
| Name | 2-Methyl-5-Nitro-1H-Benzimidazole 3-Oxide |
|---|---|
| Synonyms | 1-Hydroxy-2-Methyl-6-Nitro-Benzimidazole; Nsc116844 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 |
| CAS Registry Number | 4615-69-4 |
| SMILES | C2=C1[N](O)C(=NC1=CC=C2[N+]([O-])=O)C |
| InChI | 1S/C8H7N3O3/c1-5-9-7-3-2-6(11(13)14)4-8(7)10(5)12/h2-4,12H,1H3 |
| InChIKey | UWBNPKAUKQNJCM-UHFFFAOYSA-N |
| Density | 1.588g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.255°C at 760 mmHg (Cal.) |
| Flash point | 230.944°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-Nitro-1H-Benzimidazole 3-Oxide |