|
CAS#: 46263-35-8 Product: Nafomine No suppilers available for the product. |
| Name | Nafomine |
|---|---|
| Synonyms | O-[(2-Methyl-1-Naphthyl)Methyl]Hydroxylamine; Nafomine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 46263-35-8 |
| SMILES | C2=C1C(=C(C=CC1=CC=C2)C)CON |
| InChI | 1S/C12H13NO/c1-9-6-7-10-4-2-3-5-11(10)12(9)8-14-13/h2-7H,8,13H2,1H3 |
| InChIKey | DSBSLDVRDBLLFL-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.367°C at 760 mmHg (Cal.) |
| Flash point | 200.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nafomine |