|
CAS#: 46377-45-1 Product: 2,5-Dihydro-2,3-Dimethyl-1,2,4-Benzothiadiazepine 1,1-Dioxide No suppilers available for the product. |
| Name | 2,5-Dihydro-2,3-Dimethyl-1,2,4-Benzothiadiazepine 1,1-Dioxide |
|---|---|
| Synonyms | 1,2,4-Benzothiadiazepine, 2,5-Dihydro-2,3-Dimethyl-, 1,1-Dioxide; 2,5-Dihydro-2,3-Dimethyl-1,2,4-Benzothiadiazepine 1,1-Dioxide; Brn 0986239 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 |
| CAS Registry Number | 46377-45-1 |
| SMILES | C2=C1[S](=O)(=O)N(C(=NCC1=CC=C2)C)C |
| InChI | 1S/C10H12N2O2S/c1-8-11-7-9-5-3-4-6-10(9)15(13,14)12(8)2/h3-6H,7H2,1-2H3 |
| InChIKey | ZUXPQFYQCGDBHM-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.383°C at 760 mmHg (Cal.) |
| Flash point | 179.616°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dihydro-2,3-Dimethyl-1,2,4-Benzothiadiazepine 1,1-Dioxide |