|
CAS#: 46495-39-0 Product: [(2R,3R,5R,6S)-2,3,4,5,6-Pentahydroxycyclohexyl]Oxyphosphonic Acid No suppilers available for the product. |
| Name | [(2R,3R,5R,6S)-2,3,4,5,6-Pentahydroxycyclohexyl]Oxyphosphonic Acid |
|---|---|
| Synonyms | Inositol Monophosphate; Myo-Inositol, 1-(Dihydrogen Phosphate); 1D-Myo-Inositol 4-Monophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 |
| CAS Registry Number | 46495-39-0 (573-35-3) |
| SMILES | O=[P](OC1C(C(C(O)C(C1O)O)O)O)(O)O |
| InChI | 1S/C6H13O9P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-11H,(H2,12,13,14) |
| InChIKey | INAPMGSXUVUWAF-UHFFFAOYSA-N |
| Density | 2.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.442°C at 760 mmHg (Cal.) |
| Flash point | 266.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2R,3R,5R,6S)-2,3,4,5,6-Pentahydroxycyclohexyl]Oxyphosphonic Acid |