|
CAS#: 465-53-2 Product: Cyclopregnol No suppilers available for the product. |
| Name | Cyclopregnol |
|---|---|
| Synonyms | 3,5-Cyclopregnan-20-One, 6-Hydroxy-, (3Beta,5S,6Beta)-; 3Beta,5-Cyclo-5Beta-Pregnan-20-One, 6Beta-Hydroxy-; 6Beta-Hydroxy-3,5-Cyclopregnan-20-One |
| Molecular Structure | ![]() |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 |
| CAS Registry Number | 465-53-2 |
| SMILES | [C@]23(C1(C(C1)CC2)[C@H](O)C[C@@H]4[C@@H]3CC[C@]5([C@H]4CC[C@@H]5C(=O)C)C)C |
| InChI | 1S/C21H32O2/c1-12(22)15-4-5-16-14-10-18(23)21-11-13(21)6-9-20(21,3)17(14)7-8-19(15,16)2/h13-18,23H,4-11H2,1-3H3/t13?,14-,15+,16-,17-,18+,19+,20+,21?/m0/s1 |
| InChIKey | UGIARLNNAPRCPF-VMOOXPTGSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.27°C at 760 mmHg (Cal.) |
| Flash point | 185.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclopregnol |