|
CAS#: 465-77-0 Product: Ethyl 2,3,4,5-Tetrachlorotetrahydro-2-Furancarboxylate No suppilers available for the product. |
| Name | Ethyl 2,3,4,5-Tetrachlorotetrahydro-2-Furancarboxylate |
|---|---|
| Synonyms | ethyl 2,3,4,5-tetrachlorotetrahydro-2-furoate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8Cl4O3 |
| Molecular Weight | 281.95 |
| CAS Registry Number | 465-77-0 |
| SMILES | ClC1C(Cl)(OC(Cl)C1Cl)C(=O)OCC |
| InChI | 1S/C7H8Cl4O3/c1-2-13-6(12)7(11)4(9)3(8)5(10)14-7/h3-5H,2H2,1H3 |
| InChIKey | VZCGXLVTQVOWKB-UHFFFAOYSA-N |
| Density | 1.531g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.559°C at 760 mmHg (Cal.) |
| Flash point | 136.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,3,4,5-Tetrachlorotetrahydro-2-Furancarboxylate |