| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Aspidospermine |
|---|---|
| Synonyms | Nsc61811; Aids-002663; Aids002663 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 |
| CAS Registry Number | 466-49-9 |
| EINECS | 207-376-7 |
| SMILES | [C@]125[C@H]4[C@@](CC[C@H]1N(C(C)=O)C3=C2C=CC=C3OC)(CCCN4CC5)CC |
| InChI | 1S/C22H30N2O2/c1-4-21-10-6-13-23-14-12-22(20(21)23)16-7-5-8-17(26-3)19(16)24(15(2)25)18(22)9-11-21/h5,7-8,18,20H,4,6,9-14H2,1-3H3/t18-,20-,21-,22-/m1/s1 |
| InChIKey | ARQOGCYMPUOVHK-ZHHKINOHSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.8±50.0°C at 760 mmHg (Cal.) |
| Flash point | 282.1±30.1°C (Cal.) |
| (1) | Jared T. Shaw. Naturally diverse: highlights in versatile synthetic methods enabling target- and diversity-oriented synthesis, Nat. Prod. Rep., 2009, 26, 11. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Aspidospermine |