|
CAS#: 466-81-9 Product: beta-Erythroidine No suppilers available for the product. |
| Name | beta-Erythroidine |
|---|---|
| Synonyms | Beta-Erythroidine, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 |
| CAS Registry Number | 466-81-9 |
| SMILES | [C@]123C4=C(CC[NH+]1CC=C2C=C[C@@H](C3)OC)COC(C4)=O.[Cl-] |
| InChI | 1S/C16H19NO3.ClH/c1-19-13-3-2-12-5-7-17-6-4-11-10-20-15(18)8-14(11)16(12,17)9-13;/h2-3,5,13H,4,6-10H2,1H3;1H/t13-,16-;/m0./s1 |
| InChIKey | PLENFHSJZZDRNT-LINSIKMZSA-N |
| Boiling point | 517°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 266.5°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for beta-Erythroidine |