|
CAS#: 46843-88-3 Product: gamma-Glutamylhistamine No suppilers available for the product. |
| Name | gamma-Glutamylhistamine |
|---|---|
| Synonyms | (2S)-5-Amino-2-[2-(3H-Imidazol-4-Yl)Ethylamino]-5-Oxo-Pentanoic Acid; (2S)-5-Amino-2-[2-(3H-Imidazol-4-Yl)Ethylamino]-5-Keto-Valeric Acid; L-Glutamine, N-(2-(1H-Imidazol-4-Yl)Ethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 46843-88-3 |
| SMILES | [C@H](C(=O)O)(NCCC1=CN=C[NH]1)CCC(=O)N |
| InChI | 1S/C10H16N4O3/c11-9(15)2-1-8(10(16)17)13-4-3-7-5-12-6-14-7/h5-6,8,13H,1-4H2,(H2,11,15)(H,12,14)(H,16,17)/t8-/m0/s1 |
| InChIKey | LLLFSMLLRVNLQB-QMMMGPOBSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 661.79°C at 760 mmHg (Cal.) |
| Flash point | 354.038°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for gamma-Glutamylhistamine |