Online Database of Chemicals from Around the World
|
CAS#: 46910-44-5 Product: 2,2'-Dithiobis(Methylene)Bis(Pyridine-1-Oxide) No suppilers available for the product. |
| Name | 2,2'-Dithiobis(Methylene)Bis(Pyridine-1-Oxide) |
|---|---|
| Synonyms | 1-Oxido-2-[(1-Oxido-2-Pyridin-1-Iumyl)Methyldisulfanylmethyl]Pyridin-1-Ium; Pyridine, 2,2'-Dithiodimethylenedi-, 1,1'-Dioxide; 2,2'-Dithiodimethylenedipyridine 1,1'-Dioxide |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.36 |
| CAS Registry Number | 46910-44-5 |
| SMILES | C2=C(CSSCC1=CC=CC=[N+]1[O-])[N+](=CC=C2)[O-] |
| InChI | 1S/C12H12N2O2S2/c15-13-7-3-1-5-11(13)9-17-18-10-12-6-2-4-8-14(12)16/h1-8H,9-10H2 |
| InChIKey | VLXZJQLHHYPSBY-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.748°C at 760 mmHg (Cal.) |
| Flash point | 326.193°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Dithiobis(Methylene)Bis(Pyridine-1-Oxide) |